C21H23F2NO3 — CID 90885317
ethyl 4-(2,3-difluorophenyl)-2,6,6-trimethyl-5-oxo-4,4a,7,8-tetrahydroquinoline-3-carboxylate (PubChem CID 90885317) has the molecular formula C21H23F2NO3 and a molecular weight of 375.42 g/mol. Its IUPAC name is ethyl 4-(2,3-difluorophenyl)-2,6,6-trimethyl-5-oxo-4,4a,7,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | ethyl 4-(2,3-difluorophenyl)-2,6,6-trimethyl-5-oxo-4,4a,7,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 90885317 |
| Molecular Formula | C21H23F2NO3 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | ethyl 4-(2,3-difluorophenyl)-2,6,6-trimethyl-5-oxo-4,4a,7,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C2CCC(C)(C)C(=O)C2C1c1cccc(F)c1F |
| InChI | InChI=1S/C21H23F2NO3/c1-5-27-20(26)15-11(2)24-14-9-10-21(3,4)19(25)17(14)16(15)12-7-6-8-13(22)18(12)23/h6-8,16-17H,5,9-10H2,1-4H3 |
| InChIKey | LERVONIJZJRFPQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |