About 3-decyl-1H-pyridin-2-one
3-decyl-1H-pyridin-2-one (PubChem CID 90885454) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is 3-decyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-decyl-1H-pyridin-2-one |
| PubChem CID | 90885454 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 3-decyl-1H-pyridin-2-one |
| SMILES | CCCCCCCCCCc1ccc[nH]c1=O |
| InChI | InChI=1S/C15H25NO/c1-2-3-4-5-6-7-8-9-11-14-12-10-13-16-15(14)17/h10,12-13H,2-9,11H2,1H3,(H,16,17) |
| InChIKey | SQMVHXXNPLWABO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-decyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-decyl-1H-pyridin-2-one?
The IUPAC name of 3-decyl-1H-pyridin-2-one (CID 90885454) is 3-decyl-1H-pyridin-2-one.
What is the SMILES notation for 3-decyl-1H-pyridin-2-one?
The canonical SMILES for 3-decyl-1H-pyridin-2-one is CCCCCCCCCCc1ccc[nH]c1=O.
What is the InChIKey of 3-decyl-1H-pyridin-2-one?
The InChIKey is SQMVHXXNPLWABO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-2-3-4-5-6-7-8-9-11-14-12-10-13-16-15(14)17/h10,12-13H,2-9,11H2,1H3,(H,16,17).
What are the key properties of 3-decyl-1H-pyridin-2-one?
3-decyl-1H-pyridin-2-one has a molecular weight of 235.37 g/mol, XLogP of 4.06, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-decyl-1H-pyridin-2-one is sourced from PubChem (CID 90885454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).