C15H23NO2 — CID 90885632
1-[(1S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]piperidine-2,4-dione (PubChem CID 90885632) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 1-[(1S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]piperidine-2,4-dione.
| Compound Name | 1-[(1S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]piperidine-2,4-dione |
|---|---|
| PubChem CID | 90885632 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 1-[(1S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]piperidine-2,4-dione |
| SMILES | CC1(C)C(N2CCC(=O)CC2=O)[C@@]2(C)CC[C@@H]1C2 |
| InChI | InChI=1S/C15H23NO2/c1-14(2)10-4-6-15(3,9-10)13(14)16-7-5-11(17)8-12(16)18/h10,13H,4-9H2,1-3H3/t10-,13?,15+/m1/s1 |
| InChIKey | VJWZKBPDANWLQG-HIHIVVGNSA-N |
| XLogP | 2.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|