C10H13N — CID 90885673
1-methyl-3,4,5,6-tetrahydroisoquinoline (PubChem CID 90885673) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 1-methyl-3,4,5,6-tetrahydroisoquinoline.
| Compound Name | 1-methyl-3,4,5,6-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 90885673 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 1-methyl-3,4,5,6-tetrahydroisoquinoline |
| SMILES | CC1=NCCC2=C1C=CCC2 |
| InChI | InChI=1S/C10H13N/c1-8-10-5-3-2-4-9(10)6-7-11-8/h3,5H,2,4,6-7H2,1H3 |
| InChIKey | PZGOQHWYBHNTKI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |