C20H35N — CID 90885755
N-(1-cycloheptylethenyl)-N,4,7-trimethylocta-4,6-dien-1-amine (PubChem CID 90885755) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is N-(1-cycloheptylethenyl)-N,4,7-trimethylocta-4,6-dien-1-amine.
| Compound Name | N-(1-cycloheptylethenyl)-N,4,7-trimethylocta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 90885755 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | N-(1-cycloheptylethenyl)-N,4,7-trimethylocta-4,6-dien-1-amine |
| SMILES | C=C(C1CCCCCC1)N(C)CCCC(C)=CC=C(C)C |
| InChI | InChI=1S/C20H35N/c1-17(2)14-15-18(3)11-10-16-21(5)19(4)20-12-8-6-7-9-13-20/h14-15,20H,4,6-13,16H2,1-3,5H3 |
| InChIKey | XYWJIXDFVNMGES-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|