About [3,5-dichloro-2-(4-chlorophenyl)phenyl] pyrazine-2-carboxylate
[3,5-dichloro-2-(4-chlorophenyl)phenyl] pyrazine-2-carboxylate (PubChem CID 90886052) has the molecular formula C17H9Cl3N2O2
and a molecular weight of 379.63 g/mol. Its IUPAC name is [3,5-dichloro-2-(4-chlorophenyl)phenyl] pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | [3,5-dichloro-2-(4-chlorophenyl)phenyl] pyrazine-2-carboxylate |
| PubChem CID | 90886052 |
| Molecular Formula | C17H9Cl3N2O2 |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | [3,5-dichloro-2-(4-chlorophenyl)phenyl] pyrazine-2-carboxylate |
| SMILES | O=C(Oc1cc(Cl)cc(Cl)c1-c1ccc(Cl)cc1)c1cnccn1 |
| InChI | InChI=1S/C17H9Cl3N2O2/c18-11-3-1-10(2-4-11)16-13(20)7-12(19)8-15(16)24-17(23)14-9-21-5-6-22-14/h1-9H |
| InChIKey | NJGZYNDJAQXJFI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3,5-dichloro-2-(4-chlorophenyl)phenyl] pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dichloro-2-(4-chlorophenyl)phenyl] pyrazine-2-carboxylate?
The IUPAC name of [3,5-dichloro-2-(4-chlorophenyl)phenyl] pyrazine-2-carboxylate (CID 90886052) is [3,5-dichloro-2-(4-chlorophenyl)phenyl] pyrazine-2-carboxylate.
What is the SMILES notation for [3,5-dichloro-2-(4-chlorophenyl)phenyl] pyrazine-2-carboxylate?
The canonical SMILES for [3,5-dichloro-2-(4-chlorophenyl)phenyl] pyrazine-2-carboxylate is O=C(Oc1cc(Cl)cc(Cl)c1-c1ccc(Cl)cc1)c1cnccn1.
What is the InChIKey of [3,5-dichloro-2-(4-chlorophenyl)phenyl] pyrazine-2-carboxylate?
The InChIKey is NJGZYNDJAQXJFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9Cl3N2O2/c18-11-3-1-10(2-4-11)16-13(20)7-12(19)8-15(16)24-17(23)14-9-21-5-6-22-14/h1-9H.
What are the key properties of [3,5-dichloro-2-(4-chlorophenyl)phenyl] pyrazine-2-carboxylate?
[3,5-dichloro-2-(4-chlorophenyl)phenyl] pyrazine-2-carboxylate has a molecular weight of 379.63 g/mol, XLogP of 5.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dichloro-2-(4-chlorophenyl)phenyl] pyrazine-2-carboxylate is sourced from PubChem (CID 90886052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).