About 2-butan-2-yl-1,3-dimethylaziridine
2-butan-2-yl-1,3-dimethylaziridine (PubChem CID 90886206) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is 2-butan-2-yl-1,3-dimethylaziridine.
Molecular Properties
| Compound Name | 2-butan-2-yl-1,3-dimethylaziridine |
| PubChem CID | 90886206 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | 2-butan-2-yl-1,3-dimethylaziridine |
| SMILES | CCC(C)C1C(C)N1C |
| InChI | InChI=1S/C8H17N/c1-5-6(2)8-7(3)9(8)4/h6-8H,5H2,1-4H3 |
| InChIKey | QBDVFYFZSYTFCM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-butan-2-yl-1,3-dimethylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-1,3-dimethylaziridine?
The IUPAC name of 2-butan-2-yl-1,3-dimethylaziridine (CID 90886206) is 2-butan-2-yl-1,3-dimethylaziridine.
What is the SMILES notation for 2-butan-2-yl-1,3-dimethylaziridine?
The canonical SMILES for 2-butan-2-yl-1,3-dimethylaziridine is CCC(C)C1C(C)N1C.
What is the InChIKey of 2-butan-2-yl-1,3-dimethylaziridine?
The InChIKey is QBDVFYFZSYTFCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N/c1-5-6(2)8-7(3)9(8)4/h6-8H,5H2,1-4H3.
What are the key properties of 2-butan-2-yl-1,3-dimethylaziridine?
2-butan-2-yl-1,3-dimethylaziridine has a molecular weight of 127.23 g/mol, XLogP of 1.74, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-1,3-dimethylaziridine is sourced from PubChem (CID 90886206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).