C22H44N4O3 — CID 90886793
N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-2-methylpropanamide (PubChem CID 90886793) has the molecular formula C22H44N4O3 and a molecular weight of 412.62 g/mol. Its IUPAC name is N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-2-methylpropanamide.
| Compound Name | N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-2-methylpropanamide |
|---|---|
| PubChem CID | 90886793 |
| Molecular Formula | C22H44N4O3 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.34 |
| IUPAC Name | N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-2-methylpropanamide |
| SMILES | CC(C)(NC1CC(C)(C)N(O)C(C)(C)C1)C(=O)NC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C22H44N4O3/c1-18(2)11-15(12-19(3,4)25(18)28)23-17(27)22(9,10)24-16-13-20(5,6)26(29)21(7,8)14-16/h15-16,24,28-29H,11-14H2,1-10H3,(H,23,27) |
| InChIKey | VDJVGLAYHAOQON-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |