About 5-methoxydec-3-en-2-one
5-methoxydec-3-en-2-one (PubChem CID 90886930) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 5-methoxydec-3-en-2-one.
Molecular Properties
| Compound Name | 5-methoxydec-3-en-2-one |
| PubChem CID | 90886930 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 5-methoxydec-3-en-2-one |
| SMILES | CCCCCC(C=CC(C)=O)OC |
| InChI | InChI=1S/C11H20O2/c1-4-5-6-7-11(13-3)9-8-10(2)12/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | GQEGMYIMAWTVLP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxydec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxydec-3-en-2-one?
The IUPAC name of 5-methoxydec-3-en-2-one (CID 90886930) is 5-methoxydec-3-en-2-one.
What is the SMILES notation for 5-methoxydec-3-en-2-one?
The canonical SMILES for 5-methoxydec-3-en-2-one is CCCCCC(C=CC(C)=O)OC.
What is the InChIKey of 5-methoxydec-3-en-2-one?
The InChIKey is GQEGMYIMAWTVLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-4-5-6-7-11(13-3)9-8-10(2)12/h8-9,11H,4-7H2,1-3H3.
What are the key properties of 5-methoxydec-3-en-2-one?
5-methoxydec-3-en-2-one has a molecular weight of 184.28 g/mol, XLogP of 2.73, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxydec-3-en-2-one is sourced from PubChem (CID 90886930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).