C20H23F3N4O — CID 90887533
2-amino-2-[[6-[1-(7-methanimidoylcyclohepta-1,3,6-trien-1-yl)ethenyl]-5-(trifluoromethyl)-2-pyridinyl]amino]butan-1-ol (PubChem CID 90887533) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is 2-amino-2-[[6-[1-(7-methanimidoylcyclohepta-1,3,6-trien-1-yl)ethenyl]-5-(trifluoromethyl)-2-pyridinyl]amino]butan-1-ol.
| Compound Name | 2-amino-2-[[6-[1-(7-methanimidoylcyclohepta-1,3,6-trien-1-yl)ethenyl]-5-(trifluoromethyl)-2-pyridinyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 90887533 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-amino-2-[[6-[1-(7-methanimidoylcyclohepta-1,3,6-trien-1-yl)ethenyl]-5-(trifluoromethyl)-2-pyridinyl]amino]butan-1-ol |
| SMILES | [H]/N=C/C1=CCC=CC=C1C(=C)c1nc(NC(N)(CC)CO)ccc1C(F)(F)F |
| InChI | InChI=1S/C20H23F3N4O/c1-3-19(25,12-28)27-17-10-9-16(20(21,22)23)18(26-17)13(2)15-8-6-4-5-7-14(15)11-24/h4,6-11,24,28H,2-3,5,12,25H2,1H3,(H,26,27)/b24-11+ |
| InChIKey | LYDOFIOAUIAOFN-BHGWPJFGSA-N |
| XLogP | 4.05 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|