About [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 3,3-dimethylbutanoate
[2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 3,3-dimethylbutanoate (PubChem CID 90887818) has the molecular formula C26H28F2O5S2
and a molecular weight of 522.64 g/mol. Its IUPAC name is [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 3,3-dimethylbutanoate |
| PubChem CID | 90887818 |
| Molecular Formula | C26H28F2O5S2 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)OCC(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28F2O5S2/c1-25(2,3)19-24(29)32-20-26(27,28)35(30,31)33-34(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18H,19-20H2,1-3H3 |
| InChIKey | DUHHABQSVJXRMA-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 3,3-dimethylbutanoate?
The IUPAC name of [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 3,3-dimethylbutanoate (CID 90887818) is [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 3,3-dimethylbutanoate.
What is the SMILES notation for [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 3,3-dimethylbutanoate?
The canonical SMILES for [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 3,3-dimethylbutanoate is CC(C)(C)CC(=O)OCC(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 3,3-dimethylbutanoate?
The InChIKey is DUHHABQSVJXRMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28F2O5S2/c1-25(2,3)19-24(29)32-20-26(27,28)35(30,31)33-34(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18H,19-20H2,1-3H3.
What are the key properties of [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 3,3-dimethylbutanoate?
[2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 3,3-dimethylbutanoate has a molecular weight of 522.64 g/mol, XLogP of 6.80, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 3,3-dimethylbutanoate is sourced from PubChem (CID 90887818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).