C12H15ClN4O3S — CID 9088882
1-tert-butyl-3-[(5-chloro-2-nitrobenzoyl)amino]thiourea (PubChem CID 9088882) has the molecular formula C12H15ClN4O3S and a molecular weight of 330.80 g/mol. Its IUPAC name is 1-tert-butyl-3-[(5-chloro-2-nitrobenzoyl)amino]thiourea.
| Compound Name | 1-tert-butyl-3-[(5-chloro-2-nitrobenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 9088882 |
| Molecular Formula | C12H15ClN4O3S |
| Molecular Weight | 330.80 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 1-tert-butyl-3-[(5-chloro-2-nitrobenzoyl)amino]thiourea |
| SMILES | CC(C)(C)NC(=S)NNC(=O)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15ClN4O3S/c1-12(2,3)14-11(21)16-15-10(18)8-6-7(13)4-5-9(8)17(19)20/h4-6H,1-3H3,(H,15,18)(H2,14,16,21) |
| InChIKey | DPPYREYUDCQIPS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.80 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|