C29H31F3O2S — CID 90888872
[2-methyl-4-[(1S)-1-[4-[4-(trifluoromethyl)phenyl]phenyl]pentyl]sulfanylphenyl] butanoate (PubChem CID 90888872) has the molecular formula C29H31F3O2S and a molecular weight of 500.63 g/mol. Its IUPAC name is [2-methyl-4-[(1S)-1-[4-[4-(trifluoromethyl)phenyl]phenyl]pentyl]sulfanylphenyl] butanoate.
| Compound Name | [2-methyl-4-[(1S)-1-[4-[4-(trifluoromethyl)phenyl]phenyl]pentyl]sulfanylphenyl] butanoate |
|---|---|
| PubChem CID | 90888872 |
| Molecular Formula | C29H31F3O2S |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | [2-methyl-4-[(1S)-1-[4-[4-(trifluoromethyl)phenyl]phenyl]pentyl]sulfanylphenyl] butanoate |
| SMILES | CCCC[C@H](Sc1ccc(OC(=O)CCC)c(C)c1)c1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H31F3O2S/c1-4-6-8-27(35-25-17-18-26(20(3)19-25)34-28(33)7-5-2)23-11-9-21(10-12-23)22-13-15-24(16-14-22)29(30,31)32/h9-19,27H,4-8H2,1-3H3/t27-/m0/s1 |
| InChIKey | DZECUHQREFTJOY-MHZLTWQESA-N |
| XLogP | 9.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|