C18H42N4 — CID 90889104
5-[2-(dimethylamino)ethyl]-N,N,N'-trimethyl-4-(methylaminomethyl)nonane-1,9-diamine (PubChem CID 90889104) has the molecular formula C18H42N4 and a molecular weight of 314.56 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethyl]-N,N,N'-trimethyl-4-(methylaminomethyl)nonane-1,9-diamine.
| Compound Name | 5-[2-(dimethylamino)ethyl]-N,N,N'-trimethyl-4-(methylaminomethyl)nonane-1,9-diamine |
|---|---|
| PubChem CID | 90889104 |
| Molecular Formula | C18H42N4 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.34 |
| IUPAC Name | 5-[2-(dimethylamino)ethyl]-N,N,N'-trimethyl-4-(methylaminomethyl)nonane-1,9-diamine |
| SMILES | CNCCCCC(CCN(C)C)C(CCCN(C)C)CNC |
| InChI | InChI=1S/C18H42N4/c1-19-13-8-7-10-17(12-15-22(5)6)18(16-20-2)11-9-14-21(3)4/h17-20H,7-16H2,1-6H3 |
| InChIKey | FEZYPIZTBKGXSB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|