C20H26N8O3S — CID 90889297
ethane;[[4-(methylamino)-6-(2-methyl-4-phenyldiazenylanilino)-1,3,5-triazin-2-yl]amino]methanesulfonic acid (PubChem CID 90889297) has the molecular formula C20H26N8O3S and a molecular weight of 458.55 g/mol. Its IUPAC name is ethane;[[4-(methylamino)-6-(2-methyl-4-phenyldiazenylanilino)-1,3,5-triazin-2-yl]amino]methanesulfonic acid.
| Compound Name | ethane;[[4-(methylamino)-6-(2-methyl-4-phenyldiazenylanilino)-1,3,5-triazin-2-yl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 90889297 |
| Molecular Formula | C20H26N8O3S |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | ethane;[[4-(methylamino)-6-(2-methyl-4-phenyldiazenylanilino)-1,3,5-triazin-2-yl]amino]methanesulfonic acid |
| SMILES | CC.CNc1nc(NCS(=O)(=O)O)nc(Nc2ccc(/N=N/c3ccccc3)cc2C)n1 |
| InChI | InChI=1S/C18H20N8O3S.C2H6/c1-12-10-14(26-25-13-6-4-3-5-7-13)8-9-15(12)21-18-23-16(19-2)22-17(24-18)20-11-30(27,28)29;1-2/h3-10H,11H2,1-2H3,(H,27,28,29)(H3,19,20,21,22,23,24);1-2H3/b26-25+; |
| InChIKey | DVQKZMZLMZDIOY-BTKVJIOYSA-N |
| XLogP | 4.66 |
| TPSA | 153.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|