C33H43NO2 — CID 90890729
3-[4-[4-(propylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenol (PubChem CID 90890729) has the molecular formula C33H43NO2 and a molecular weight of 485.71 g/mol. Its IUPAC name is 3-[4-[4-(propylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenol.
| Compound Name | 3-[4-[4-(propylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenol |
|---|---|
| PubChem CID | 90890729 |
| Molecular Formula | C33H43NO2 |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | 3-[4-[4-(propylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenol |
| SMILES | CCCNCCCCOc1ccc(-c2cccc(O)c2)cc1-c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C33H43NO2/c1-6-18-34-19-7-8-20-36-31-15-13-25(24-10-9-11-27(35)21-24)22-28(31)26-12-14-29-30(23-26)33(4,5)17-16-32(29,2)3/h9-15,21-23,34-35H,6-8,16-20H2,1-5H3 |
| InChIKey | MSYQGNDHRBVJAP-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|