C27H50 — CID 90890989
(1S,2S,3R,3aS,4R,5R,6R,7R,7aR)-1,3,5-tritert-butyl-2,4,6-trimethyl-7-prop-1-en-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 90890989) has the molecular formula C27H50 and a molecular weight of 374.70 g/mol. Its IUPAC name is (1S,2S,3R,3aS,4R,5R,6R,7R,7aR)-1,3,5-tritert-butyl-2,4,6-trimethyl-7-prop-1-en-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | (1S,2S,3R,3aS,4R,5R,6R,7R,7aR)-1,3,5-tritert-butyl-2,4,6-trimethyl-7-prop-1-en-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 90890989 |
| Molecular Formula | C27H50 |
| Molecular Weight | 374.70 g/mol |
| Exact Mass | 374.39 |
| IUPAC Name | (1S,2S,3R,3aS,4R,5R,6R,7R,7aR)-1,3,5-tritert-butyl-2,4,6-trimethyl-7-prop-1-en-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | C=C(C)[C@@H]1[C@H](C)[C@H](C(C)(C)C)[C@H](C)[C@H]2[C@@H]1[C@@H](C(C)(C)C)[C@@H](C)[C@H]2C(C)(C)C |
| InChI | InChI=1S/C27H50/c1-15(2)19-16(3)22(25(6,7)8)17(4)20-21(19)24(27(12,13)14)18(5)23(20)26(9,10)11/h16-24H,1H2,2-14H3/t16-,17+,18-,19+,20-,21+,22-,23+,24-/m0/s1 |
| InChIKey | QLWHYICKIKKZFT-IAIYJBJBSA-N |
| XLogP | 8.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.70 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|