C24H21Cl2N7S2 — CID 90890991
5-(5,7-dichlorocyclohepta-1,2,4,6-tetraen-1-yl)-N-[4-(4-methylpiperazin-1-yl)-6-phenylsulfanyl-1,3,5-triazin-2-yl]-1,3-thiazol-2-amine (PubChem CID 90890991) has the molecular formula C24H21Cl2N7S2 and a molecular weight of 542.52 g/mol. Its IUPAC name is 5-(5,7-dichlorocyclohepta-1,2,4,6-tetraen-1-yl)-N-[4-(4-methylpiperazin-1-yl)-6-phenylsulfanyl-1,3,5-triazin-2-yl]-1,3-thiazol-2-amine.
| Compound Name | 5-(5,7-dichlorocyclohepta-1,2,4,6-tetraen-1-yl)-N-[4-(4-methylpiperazin-1-yl)-6-phenylsulfanyl-1,3,5-triazin-2-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 90890991 |
| Molecular Formula | C24H21Cl2N7S2 |
| Molecular Weight | 542.52 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | 5-(5,7-dichlorocyclohepta-1,2,4,6-tetraen-1-yl)-N-[4-(4-methylpiperazin-1-yl)-6-phenylsulfanyl-1,3,5-triazin-2-yl]-1,3-thiazol-2-amine |
| SMILES | CN1CCN(c2nc(Nc3ncc(C4=C=CC=C(Cl)C=C4Cl)s3)nc(Sc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C24H21Cl2N7S2/c1-32-10-12-33(13-11-32)22-28-21(30-24(31-22)34-17-7-3-2-4-8-17)29-23-27-15-20(35-23)18-9-5-6-16(25)14-19(18)26/h2-8,14-15H,10-13H2,1H3,(H,27,28,29,30,31) |
| InChIKey | QFONMMANHSGNCO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |