About 2-chloro-5-[(5-chloro-1,3-benzoxazol-2-yl)-phenylsulfamoyl]benzoic acid
2-chloro-5-[(5-chloro-1,3-benzoxazol-2-yl)-phenylsulfamoyl]benzoic acid (PubChem CID 90891021) has the molecular formula C20H12Cl2N2O5S
and a molecular weight of 463.30 g/mol. Its IUPAC name is 2-chloro-5-[(5-chloro-1,3-benzoxazol-2-yl)-phenylsulfamoyl]benzoic acid.
Molecular Properties
| Compound Name | 2-chloro-5-[(5-chloro-1,3-benzoxazol-2-yl)-phenylsulfamoyl]benzoic acid |
| PubChem CID | 90891021 |
| Molecular Formula | C20H12Cl2N2O5S |
| Molecular Weight | 463.30 g/mol |
| Exact Mass | 461.98 |
| IUPAC Name | 2-chloro-5-[(5-chloro-1,3-benzoxazol-2-yl)-phenylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)N(c2ccccc2)c2nc3cc(Cl)ccc3o2)ccc1Cl |
| InChI | InChI=1S/C20H12Cl2N2O5S/c21-12-6-9-18-17(10-12)23-20(29-18)24(13-4-2-1-3-5-13)30(27,28)14-7-8-16(22)15(11-14)19(25)26/h1-11H,(H,25,26) |
| InChIKey | CGAPXZQCGVOHLQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.30 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-5-[(5-chloro-1,3-benzoxazol-2-yl)-phenylsulfamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[(5-chloro-1,3-benzoxazol-2-yl)-phenylsulfamoyl]benzoic acid?
The IUPAC name of 2-chloro-5-[(5-chloro-1,3-benzoxazol-2-yl)-phenylsulfamoyl]benzoic acid (CID 90891021) is 2-chloro-5-[(5-chloro-1,3-benzoxazol-2-yl)-phenylsulfamoyl]benzoic acid.
What is the SMILES notation for 2-chloro-5-[(5-chloro-1,3-benzoxazol-2-yl)-phenylsulfamoyl]benzoic acid?
The canonical SMILES for 2-chloro-5-[(5-chloro-1,3-benzoxazol-2-yl)-phenylsulfamoyl]benzoic acid is O=C(O)c1cc(S(=O)(=O)N(c2ccccc2)c2nc3cc(Cl)ccc3o2)ccc1Cl.
What is the InChIKey of 2-chloro-5-[(5-chloro-1,3-benzoxazol-2-yl)-phenylsulfamoyl]benzoic acid?
The InChIKey is CGAPXZQCGVOHLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12Cl2N2O5S/c21-12-6-9-18-17(10-12)23-20(29-18)24(13-4-2-1-3-5-13)30(27,28)14-7-8-16(22)15(11-14)19(25)26/h1-11H,(H,25,26).
What are the key properties of 2-chloro-5-[(5-chloro-1,3-benzoxazol-2-yl)-phenylsulfamoyl]benzoic acid?
2-chloro-5-[(5-chloro-1,3-benzoxazol-2-yl)-phenylsulfamoyl]benzoic acid has a molecular weight of 463.30 g/mol, XLogP of 5.36, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[(5-chloro-1,3-benzoxazol-2-yl)-phenylsulfamoyl]benzoic acid is sourced from PubChem (CID 90891021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).