C21H10F2O6 — CID 90891102
6,7-difluoro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbaldehyde (PubChem CID 90891102) has the molecular formula C21H10F2O6 and a molecular weight of 396.30 g/mol. Its IUPAC name is 6,7-difluoro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbaldehyde.
| Compound Name | 6,7-difluoro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbaldehyde |
|---|---|
| PubChem CID | 90891102 |
| Molecular Formula | C21H10F2O6 |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 6,7-difluoro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbaldehyde |
| SMILES | O=Cc1cc2c(c(F)c1F)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C21H10F2O6/c22-18-9(8-24)5-14-17(19(18)23)20(27)29-21(14)12-3-1-10(25)6-15(12)28-16-7-11(26)2-4-13(16)21/h1-8,25-26H |
| InChIKey | DOLXAAWSYZRSMU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|