About N'-aminobut-2-enimidamide
N'-aminobut-2-enimidamide (PubChem CID 90891227) has the molecular formula C4H9N3
and a molecular weight of 99.14 g/mol. Its IUPAC name is N'-aminobut-2-enimidamide.
Molecular Properties
| Compound Name | N'-aminobut-2-enimidamide |
| PubChem CID | 90891227 |
| Molecular Formula | C4H9N3 |
| Molecular Weight | 99.14 g/mol |
| Exact Mass | 99.08 |
| IUPAC Name | N'-aminobut-2-enimidamide |
| SMILES | CC=CC(N)=NN |
| InChI | InChI=1S/C4H9N3/c1-2-3-4(5)7-6/h2-3H,6H2,1H3,(H2,5,7) |
| InChIKey | SLJUQYCXESVSPH-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.14 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-aminobut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-aminobut-2-enimidamide?
The IUPAC name of N'-aminobut-2-enimidamide (CID 90891227) is N'-aminobut-2-enimidamide.
What is the SMILES notation for N'-aminobut-2-enimidamide?
The canonical SMILES for N'-aminobut-2-enimidamide is CC=CC(N)=NN.
What is the InChIKey of N'-aminobut-2-enimidamide?
The InChIKey is SLJUQYCXESVSPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3/c1-2-3-4(5)7-6/h2-3H,6H2,1H3,(H2,5,7).
What are the key properties of N'-aminobut-2-enimidamide?
N'-aminobut-2-enimidamide has a molecular weight of 99.14 g/mol, XLogP of -0.21, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-aminobut-2-enimidamide is sourced from PubChem (CID 90891227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).