C21H22FNO2 — CID 90891241
3-[1-[4-(4-fluorophenyl)phenyl]ethyl]-6-prop-2-enyl-1,3-oxazinan-2-one (PubChem CID 90891241) has the molecular formula C21H22FNO2 and a molecular weight of 339.41 g/mol. Its IUPAC name is 3-[1-[4-(4-fluorophenyl)phenyl]ethyl]-6-prop-2-enyl-1,3-oxazinan-2-one.
| Compound Name | 3-[1-[4-(4-fluorophenyl)phenyl]ethyl]-6-prop-2-enyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 90891241 |
| Molecular Formula | C21H22FNO2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3-[1-[4-(4-fluorophenyl)phenyl]ethyl]-6-prop-2-enyl-1,3-oxazinan-2-one |
| SMILES | C=CCC1CCN(C(C)c2ccc(-c3ccc(F)cc3)cc2)C(=O)O1 |
| InChI | InChI=1S/C21H22FNO2/c1-3-4-20-13-14-23(21(24)25-20)15(2)16-5-7-17(8-6-16)18-9-11-19(22)12-10-18/h3,5-12,15,20H,1,4,13-14H2,2H3 |
| InChIKey | BWJLKSKTSJVNLP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|