C18H29BN3+ — CID 90891338
7,8-diethyl-5,7-dimethyl-8-prop-1-en-2-yl-2,5-diaza-9-azonia-6-boratricyclo[7.4.0.02,6]trideca-1(13),9,11-triene (PubChem CID 90891338) has the molecular formula C18H29BN3+ and a molecular weight of 298.26 g/mol. Its IUPAC name is 7,8-diethyl-5,7-dimethyl-8-prop-1-en-2-yl-2,5-diaza-9-azonia-6-boratricyclo[7.4.0.02,6]trideca-1(13),9,11-triene.
| Compound Name | 7,8-diethyl-5,7-dimethyl-8-prop-1-en-2-yl-2,5-diaza-9-azonia-6-boratricyclo[7.4.0.02,6]trideca-1(13),9,11-triene |
|---|---|
| PubChem CID | 90891338 |
| Molecular Formula | C18H29BN3+ |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 7,8-diethyl-5,7-dimethyl-8-prop-1-en-2-yl-2,5-diaza-9-azonia-6-boratricyclo[7.4.0.02,6]trideca-1(13),9,11-triene |
| SMILES | C=C(C)C1(CC)[n+]2ccccc2N2CCN(C)B2C1(C)CC |
| InChI | InChI=1S/C18H29BN3/c1-7-17(5)18(8-2,15(3)4)21-12-10-9-11-16(21)22-14-13-20(6)19(17)22/h9-12H,3,7-8,13-14H2,1-2,4-6H3/q+1 |
| InChIKey | CJYNRLXWDQFYHV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|