C8H16O3 — CID 90891465
3-(2-ethenoxyethoxy)butan-2-ol (PubChem CID 90891465) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is 3-(2-ethenoxyethoxy)butan-2-ol.
| Compound Name | 3-(2-ethenoxyethoxy)butan-2-ol |
|---|---|
| PubChem CID | 90891465 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 3-(2-ethenoxyethoxy)butan-2-ol |
| SMILES | C=COCCOC(C)C(C)O |
| InChI | InChI=1S/C8H16O3/c1-4-10-5-6-11-8(3)7(2)9/h4,7-9H,1,5-6H2,2-3H3 |
| InChIKey | KLVNFYBZADMXTO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|