C7H9N3O — CID 90891491
N-(2H-1,4-diazepin-6-yl)acetamide (PubChem CID 90891491) has the molecular formula C7H9N3O and a molecular weight of 151.17 g/mol. Its IUPAC name is N-(2H-1,4-diazepin-6-yl)acetamide.
| Compound Name | N-(2H-1,4-diazepin-6-yl)acetamide |
|---|---|
| PubChem CID | 90891491 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | N-(2H-1,4-diazepin-6-yl)acetamide |
| SMILES | CC(=O)NC1=CN=CCN=C1 |
| InChI | InChI=1S/C7H9N3O/c1-6(11)10-7-4-8-2-3-9-5-7/h2,4-5H,3H2,1H3,(H,10,11) |
| InChIKey | XSEADNOJTQJKIM-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |