C24H22ClN3O3 — CID 90891576
methyl (2R,6S)-1-[(4-chlorophenyl)methyl]-4-oxo-2,6-dipyridin-2-ylpiperidine-3-carboxylate (PubChem CID 90891576) has the molecular formula C24H22ClN3O3 and a molecular weight of 435.91 g/mol. Its IUPAC name is methyl (2R,6S)-1-[(4-chlorophenyl)methyl]-4-oxo-2,6-dipyridin-2-ylpiperidine-3-carboxylate.
| Compound Name | methyl (2R,6S)-1-[(4-chlorophenyl)methyl]-4-oxo-2,6-dipyridin-2-ylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 90891576 |
| Molecular Formula | C24H22ClN3O3 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | methyl (2R,6S)-1-[(4-chlorophenyl)methyl]-4-oxo-2,6-dipyridin-2-ylpiperidine-3-carboxylate |
| SMILES | COC(=O)C1C(=O)C[C@@H](c2ccccn2)N(Cc2ccc(Cl)cc2)[C@H]1c1ccccn1 |
| InChI | InChI=1S/C24H22ClN3O3/c1-31-24(30)22-21(29)14-20(18-6-2-4-12-26-18)28(15-16-8-10-17(25)11-9-16)23(22)19-7-3-5-13-27-19/h2-13,20,22-23H,14-15H2,1H3/t20-,22?,23-/m0/s1 |
| InChIKey | HXSBNLKFZYGMOA-SLNZLALYSA-N |
| XLogP | 4.18 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|