C16H32N4O — CID 90891644
(2R)-2-(2,2-dimethylhydrazinyl)-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]propan-1-one (PubChem CID 90891644) has the molecular formula C16H32N4O and a molecular weight of 296.46 g/mol. Its IUPAC name is (2R)-2-(2,2-dimethylhydrazinyl)-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]propan-1-one.
| Compound Name | (2R)-2-(2,2-dimethylhydrazinyl)-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 90891644 |
| Molecular Formula | C16H32N4O |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | (2R)-2-(2,2-dimethylhydrazinyl)-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]propan-1-one |
| SMILES | C[C@@H](NN(C)C)C(=O)N1CCC(C2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C16H32N4O/c1-13(17-18(2)3)16(21)20-11-7-15(8-12-20)14-5-9-19(4)10-6-14/h13-15,17H,5-12H2,1-4H3/t13-/m1/s1 |
| InChIKey | HNQXAXIWFFGDNZ-CYBMUJFWSA-N |
| XLogP | 1.02 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|