About 1-[4-ethyl-2-methyl-6-(2-methylcyclopropyl)hex-3-en-2-yl]-2,3-dimethylcyclobutane
1-[4-ethyl-2-methyl-6-(2-methylcyclopropyl)hex-3-en-2-yl]-2,3-dimethylcyclobutane (PubChem CID 90891808) has the molecular formula C19H34
and a molecular weight of 262.48 g/mol. Its IUPAC name is 1-[4-ethyl-2-methyl-6-(2-methylcyclopropyl)hex-3-en-2-yl]-2,3-dimethylcyclobutane.
Molecular Properties
| Compound Name | 1-[4-ethyl-2-methyl-6-(2-methylcyclopropyl)hex-3-en-2-yl]-2,3-dimethylcyclobutane |
| PubChem CID | 90891808 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | 1-[4-ethyl-2-methyl-6-(2-methylcyclopropyl)hex-3-en-2-yl]-2,3-dimethylcyclobutane |
| SMILES | CCC(=CC(C)(C)C1CC(C)C1C)CCC1CC1C |
| InChI | InChI=1S/C19H34/c1-7-16(8-9-17-10-14(17)3)12-19(5,6)18-11-13(2)15(18)4/h12-15,17-18H,7-11H2,1-6H3 |
| InChIKey | YFLSGOPSISHZFJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-ethyl-2-methyl-6-(2-methylcyclopropyl)hex-3-en-2-yl]-2,3-dimethylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-ethyl-2-methyl-6-(2-methylcyclopropyl)hex-3-en-2-yl]-2,3-dimethylcyclobutane?
The IUPAC name of 1-[4-ethyl-2-methyl-6-(2-methylcyclopropyl)hex-3-en-2-yl]-2,3-dimethylcyclobutane (CID 90891808) is 1-[4-ethyl-2-methyl-6-(2-methylcyclopropyl)hex-3-en-2-yl]-2,3-dimethylcyclobutane.
What is the SMILES notation for 1-[4-ethyl-2-methyl-6-(2-methylcyclopropyl)hex-3-en-2-yl]-2,3-dimethylcyclobutane?
The canonical SMILES for 1-[4-ethyl-2-methyl-6-(2-methylcyclopropyl)hex-3-en-2-yl]-2,3-dimethylcyclobutane is CCC(=CC(C)(C)C1CC(C)C1C)CCC1CC1C.
What is the InChIKey of 1-[4-ethyl-2-methyl-6-(2-methylcyclopropyl)hex-3-en-2-yl]-2,3-dimethylcyclobutane?
The InChIKey is YFLSGOPSISHZFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34/c1-7-16(8-9-17-10-14(17)3)12-19(5,6)18-11-13(2)15(18)4/h12-15,17-18H,7-11H2,1-6H3.
What are the key properties of 1-[4-ethyl-2-methyl-6-(2-methylcyclopropyl)hex-3-en-2-yl]-2,3-dimethylcyclobutane?
1-[4-ethyl-2-methyl-6-(2-methylcyclopropyl)hex-3-en-2-yl]-2,3-dimethylcyclobutane has a molecular weight of 262.48 g/mol, XLogP of 6.08, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-ethyl-2-methyl-6-(2-methylcyclopropyl)hex-3-en-2-yl]-2,3-dimethylcyclobutane is sourced from PubChem (CID 90891808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).