About 3,5,6,7-tetrahydro-2H-indazole
3,5,6,7-tetrahydro-2H-indazole (PubChem CID 90891826) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 3,5,6,7-tetrahydro-2H-indazole.
Molecular Properties
| Compound Name | 3,5,6,7-tetrahydro-2H-indazole |
| PubChem CID | 90891826 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 3,5,6,7-tetrahydro-2H-indazole |
| SMILES | C1=C2CNN=C2CCC1 |
| InChI | InChI=1S/C7H10N2/c1-2-4-7-6(3-1)5-8-9-7/h3,8H,1-2,4-5H2 |
| InChIKey | DGWJCYJASPCGFD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5,6,7-tetrahydro-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,6,7-tetrahydro-2H-indazole?
The IUPAC name of 3,5,6,7-tetrahydro-2H-indazole (CID 90891826) is 3,5,6,7-tetrahydro-2H-indazole.
What is the SMILES notation for 3,5,6,7-tetrahydro-2H-indazole?
The canonical SMILES for 3,5,6,7-tetrahydro-2H-indazole is C1=C2CNN=C2CCC1.
What is the InChIKey of 3,5,6,7-tetrahydro-2H-indazole?
The InChIKey is DGWJCYJASPCGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-2-4-7-6(3-1)5-8-9-7/h3,8H,1-2,4-5H2.
What are the key properties of 3,5,6,7-tetrahydro-2H-indazole?
3,5,6,7-tetrahydro-2H-indazole has a molecular weight of 122.17 g/mol, XLogP of 1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,6,7-tetrahydro-2H-indazole is sourced from PubChem (CID 90891826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).