C30H47NO8 — CID 90892284
[(2S)-1-[(2S)-2-amino-3-[3,4-bis(2,3-dimethylbutanoyloxy)phenyl]propanoyl]oxypropan-2-yl] 2,2-dimethylbutanoate (PubChem CID 90892284) has the molecular formula C30H47NO8 and a molecular weight of 549.71 g/mol. Its IUPAC name is [(2S)-1-[(2S)-2-amino-3-[3,4-bis(2,3-dimethylbutanoyloxy)phenyl]propanoyl]oxypropan-2-yl] 2,2-dimethylbutanoate.
| Compound Name | [(2S)-1-[(2S)-2-amino-3-[3,4-bis(2,3-dimethylbutanoyloxy)phenyl]propanoyl]oxypropan-2-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90892284 |
| Molecular Formula | C30H47NO8 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | [(2S)-1-[(2S)-2-amino-3-[3,4-bis(2,3-dimethylbutanoyloxy)phenyl]propanoyl]oxypropan-2-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@@H](C)COC(=O)[C@@H](N)Cc1ccc(OC(=O)C(C)C(C)C)c(OC(=O)C(C)C(C)C)c1 |
| InChI | InChI=1S/C30H47NO8/c1-11-30(9,10)29(35)37-19(6)16-36-28(34)23(31)14-22-12-13-24(38-26(32)20(7)17(2)3)25(15-22)39-27(33)21(8)18(4)5/h12-13,15,17-21,23H,11,14,16,31H2,1-10H3/t19-,20?,21?,23-/m0/s1 |
| InChIKey | CUSVYJRPPRGAIE-XLLVLBFCSA-N |
| XLogP | 4.86 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|