C31H36ClNO3 — CID 90892434
(2R,4aS,10aR)-2-(2-chloroethynyl)-4a-[3-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]prop-2-enyl]-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol (PubChem CID 90892434) has the molecular formula C31H36ClNO3 and a molecular weight of 506.09 g/mol. Its IUPAC name is (2R,4aS,10aR)-2-(2-chloroethynyl)-4a-[3-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]prop-2-enyl]-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol.
| Compound Name | (2R,4aS,10aR)-2-(2-chloroethynyl)-4a-[3-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]prop-2-enyl]-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol |
|---|---|
| PubChem CID | 90892434 |
| Molecular Formula | C31H36ClNO3 |
| Molecular Weight | 506.09 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | (2R,4aS,10aR)-2-(2-chloroethynyl)-4a-[3-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]prop-2-enyl]-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol |
| SMILES | Oc1ccc2c(c1)CC[C@@H]1C[C@@](O)(C#CCl)CC[C@@]21CC=Cc1ccc(CN2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C31H36ClNO3/c32-17-16-30(36)14-15-31(26(21-30)8-7-25-20-28(35)9-10-29(25)31)13-1-2-23-3-5-24(6-4-23)22-33-18-11-27(34)12-19-33/h1-6,9-10,20,26-27,34-36H,7-8,11-15,18-19,21-22H2/t26-,30+,31-/m1/s1 |
| InChIKey | WUOUUZSJFPYBCX-SATCGAIXSA-N |
| XLogP | 5.37 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.09 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|