C23H28ClN3O4S — CID 90892860
4-[[[(2R)-2-carbamoylcyclohexyl]-(4-chlorophenyl)sulfonylamino]methyl]-N-ethylbenzamide (PubChem CID 90892860) has the molecular formula C23H28ClN3O4S and a molecular weight of 478.01 g/mol. Its IUPAC name is 4-[[[(2R)-2-carbamoylcyclohexyl]-(4-chlorophenyl)sulfonylamino]methyl]-N-ethylbenzamide.
| Compound Name | 4-[[[(2R)-2-carbamoylcyclohexyl]-(4-chlorophenyl)sulfonylamino]methyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 90892860 |
| Molecular Formula | C23H28ClN3O4S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 4-[[[(2R)-2-carbamoylcyclohexyl]-(4-chlorophenyl)sulfonylamino]methyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(CN(C2CCCC[C@H]2C(N)=O)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H28ClN3O4S/c1-2-26-23(29)17-9-7-16(8-10-17)15-27(21-6-4-3-5-20(21)22(25)28)32(30,31)19-13-11-18(24)12-14-19/h7-14,20-21H,2-6,15H2,1H3,(H2,25,28)(H,26,29)/t20-,21?/m1/s1 |
| InChIKey | ODWJTWBTXBEVSH-VQCQRNETSA-N |
| XLogP | 3.32 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |