About (2,5-dihydroxypyrrol-1-yl) N-[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamate
(2,5-dihydroxypyrrol-1-yl) N-[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamate (PubChem CID 90892931) has the molecular formula C13H20N4O5
and a molecular weight of 312.33 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) N-[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) N-[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamate |
| PubChem CID | 90892931 |
| Molecular Formula | C13H20N4O5 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) N-[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamate |
| SMILES | NC(=O)CN1CCC[C@H](NC(=O)On2c(O)ccc2O)CC1 |
| InChI | InChI=1S/C13H20N4O5/c14-10(18)8-16-6-1-2-9(5-7-16)15-13(21)22-17-11(19)3-4-12(17)20/h3-4,9,19-20H,1-2,5-8H2,(H2,14,18)(H,15,21)/t9-/m0/s1 |
| InChIKey | BITQNKAWZMXVFZ-VIFPVBQESA-N |
| XLogP | -0.62 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2,5-dihydroxypyrrol-1-yl) N-[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) N-[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) N-[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamate (CID 90892931) is (2,5-dihydroxypyrrol-1-yl) N-[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) N-[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) N-[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamate is NC(=O)CN1CCC[C@H](NC(=O)On2c(O)ccc2O)CC1.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) N-[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamate?
The InChIKey is BITQNKAWZMXVFZ-VIFPVBQESA-N. The full InChI is InChI=1S/C13H20N4O5/c14-10(18)8-16-6-1-2-9(5-7-16)15-13(21)22-17-11(19)3-4-12(17)20/h3-4,9,19-20H,1-2,5-8H2,(H2,14,18)(H,15,21)/t9-/m0/s1.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) N-[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamate?
(2,5-dihydroxypyrrol-1-yl) N-[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamate has a molecular weight of 312.33 g/mol, XLogP of -0.62, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) N-[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamate is sourced from PubChem (CID 90892931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).