C20H19NO3 — CID 90892975
N-methoxy-N-(6,7,8,9-tetrahydrodibenzofuran-2-yl)benzamide (PubChem CID 90892975) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-methoxy-N-(6,7,8,9-tetrahydrodibenzofuran-2-yl)benzamide.
| Compound Name | N-methoxy-N-(6,7,8,9-tetrahydrodibenzofuran-2-yl)benzamide |
|---|---|
| PubChem CID | 90892975 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N-methoxy-N-(6,7,8,9-tetrahydrodibenzofuran-2-yl)benzamide |
| SMILES | CON(C(=O)c1ccccc1)c1ccc2oc3c(c2c1)CCCC3 |
| InChI | InChI=1S/C20H19NO3/c1-23-21(20(22)14-7-3-2-4-8-14)15-11-12-19-17(13-15)16-9-5-6-10-18(16)24-19/h2-4,7-8,11-13H,5-6,9-10H2,1H3 |
| InChIKey | CHIMHFGXHICPHF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|