About 6,7-dihydro-5H-1-benzofuran-3,4-dione
6,7-dihydro-5H-1-benzofuran-3,4-dione (PubChem CID 908930) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is 6,7-dihydro-5H-1-benzofuran-3,4-dione.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-1-benzofuran-3,4-dione |
| PubChem CID | 908930 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 6,7-dihydro-5H-1-benzofuran-3,4-dione |
| SMILES | O=C1CCCC2=C1C(=O)CO2 |
| InChI | InChI=1S/C8H8O3/c9-5-2-1-3-7-8(5)6(10)4-11-7/h1-4H2 |
| InChIKey | CUTDDLOXKCKTNE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dihydro-5H-1-benzofuran-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-1-benzofuran-3,4-dione?
The IUPAC name of 6,7-dihydro-5H-1-benzofuran-3,4-dione (CID 908930) is 6,7-dihydro-5H-1-benzofuran-3,4-dione.
What is the SMILES notation for 6,7-dihydro-5H-1-benzofuran-3,4-dione?
The canonical SMILES for 6,7-dihydro-5H-1-benzofuran-3,4-dione is O=C1CCCC2=C1C(=O)CO2.
What is the InChIKey of 6,7-dihydro-5H-1-benzofuran-3,4-dione?
The InChIKey is CUTDDLOXKCKTNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c9-5-2-1-3-7-8(5)6(10)4-11-7/h1-4H2.
What are the key properties of 6,7-dihydro-5H-1-benzofuran-3,4-dione?
6,7-dihydro-5H-1-benzofuran-3,4-dione has a molecular weight of 152.15 g/mol, XLogP of 0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-1-benzofuran-3,4-dione is sourced from PubChem (CID 908930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).