C34H45N3O6 — CID 90893184
18-(dimethylamino)-2-methoxy-7-(2-methylhex-5-yn-2-yl)-6,9-dioxo-10-oxa-5,8-diazatetracyclo[15.5.3.12,5.020,24]hexacosa-1(23),17,19,21,24-pentaene-4-carboxylic acid (PubChem CID 90893184) has the molecular formula C34H45N3O6 and a molecular weight of 591.75 g/mol. Its IUPAC name is 18-(dimethylamino)-2-methoxy-7-(2-methylhex-5-yn-2-yl)-6,9-dioxo-10-oxa-5,8-diazatetracyclo[15.5.3.12,5.020,24]hexacosa-1(23),17,19,21,24-pentaene-4-carboxylic acid.
| Compound Name | 18-(dimethylamino)-2-methoxy-7-(2-methylhex-5-yn-2-yl)-6,9-dioxo-10-oxa-5,8-diazatetracyclo[15.5.3.12,5.020,24]hexacosa-1(23),17,19,21,24-pentaene-4-carboxylic acid |
|---|---|
| PubChem CID | 90893184 |
| Molecular Formula | C34H45N3O6 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.33 |
| IUPAC Name | 18-(dimethylamino)-2-methoxy-7-(2-methylhex-5-yn-2-yl)-6,9-dioxo-10-oxa-5,8-diazatetracyclo[15.5.3.12,5.020,24]hexacosa-1(23),17,19,21,24-pentaene-4-carboxylic acid |
| SMILES | C#CCCC(C)(C)C1NC(=O)OCCCCCCc2cc3cc(ccc3cc2N(C)C)C2(OC)CC(C(=O)O)N(C2)C1=O |
| InChI | InChI=1S/C34H45N3O6/c1-7-8-16-33(2,3)29-30(38)37-22-34(42-6,21-28(37)31(39)40)26-15-14-23-20-27(36(4)5)24(18-25(23)19-26)13-11-9-10-12-17-43-32(41)35-29/h1,14-15,18-20,28-29H,8-13,16-17,21-22H2,2-6H3,(H,35,41)(H,39,40) |
| InChIKey | QHWSZUWOZZSVMY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|