C14H26O5 — CID 90894108
2-[4-[4-(2-hydroxyethoxy)-3-methylbut-3-enoxy]-2-methylbut-1-enoxy]ethanol (PubChem CID 90894108) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-[4-[4-(2-hydroxyethoxy)-3-methylbut-3-enoxy]-2-methylbut-1-enoxy]ethanol.
| Compound Name | 2-[4-[4-(2-hydroxyethoxy)-3-methylbut-3-enoxy]-2-methylbut-1-enoxy]ethanol |
|---|---|
| PubChem CID | 90894108 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2-[4-[4-(2-hydroxyethoxy)-3-methylbut-3-enoxy]-2-methylbut-1-enoxy]ethanol |
| SMILES | CC(=COCCO)CCOCCC(C)=COCCO |
| InChI | InChI=1S/C14H26O5/c1-13(11-18-9-5-15)3-7-17-8-4-14(2)12-19-10-6-16/h11-12,15-16H,3-10H2,1-2H3 |
| InChIKey | HWAFECXZXOVWNS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|