C17H14F3NO3 — CID 90894382
(4S,7R)-4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-4,7-epoxyisoindole-1,3-diol (PubChem CID 90894382) has the molecular formula C17H14F3NO3 and a molecular weight of 337.30 g/mol. Its IUPAC name is (4S,7R)-4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-4,7-epoxyisoindole-1,3-diol.
| Compound Name | (4S,7R)-4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-4,7-epoxyisoindole-1,3-diol |
|---|---|
| PubChem CID | 90894382 |
| Molecular Formula | C17H14F3NO3 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | (4S,7R)-4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-4,7-epoxyisoindole-1,3-diol |
| SMILES | C[C@]12C=C[C@](C)(O1)c1c2c(O)n(-c2cccc(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C17H14F3NO3/c1-15-6-7-16(2,24-15)12-11(15)13(22)21(14(12)23)10-5-3-4-9(8-10)17(18,19)20/h3-8,22-23H,1-2H3/t15-,16+ |
| InChIKey | AXJUXADHLFOPSL-IYBDPMFKSA-N |
| XLogP | 3.94 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|