About 4-methylpiperidine;1-(4-methylpiperidin-4-yl)propan-1-one
4-methylpiperidine;1-(4-methylpiperidin-4-yl)propan-1-one (PubChem CID 90894414) has the molecular formula C15H30N2O
and a molecular weight of 254.42 g/mol. Its IUPAC name is 4-methylpiperidine;1-(4-methylpiperidin-4-yl)propan-1-one.
Molecular Properties
| Compound Name | 4-methylpiperidine;1-(4-methylpiperidin-4-yl)propan-1-one |
| PubChem CID | 90894414 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 4-methylpiperidine;1-(4-methylpiperidin-4-yl)propan-1-one |
| SMILES | CC1CCNCC1.CCC(=O)C1(C)CCNCC1 |
| InChI | InChI=1S/C9H17NO.C6H13N/c1-3-8(11)9(2)4-6-10-7-5-9;1-6-2-4-7-5-3-6/h10H,3-7H2,1-2H3;6-7H,2-5H2,1H3 |
| InChIKey | ODGIRUBALBUWGW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylpiperidine;1-(4-methylpiperidin-4-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpiperidine;1-(4-methylpiperidin-4-yl)propan-1-one?
The IUPAC name of 4-methylpiperidine;1-(4-methylpiperidin-4-yl)propan-1-one (CID 90894414) is 4-methylpiperidine;1-(4-methylpiperidin-4-yl)propan-1-one.
What is the SMILES notation for 4-methylpiperidine;1-(4-methylpiperidin-4-yl)propan-1-one?
The canonical SMILES for 4-methylpiperidine;1-(4-methylpiperidin-4-yl)propan-1-one is CC1CCNCC1.CCC(=O)C1(C)CCNCC1.
What is the InChIKey of 4-methylpiperidine;1-(4-methylpiperidin-4-yl)propan-1-one?
The InChIKey is ODGIRUBALBUWGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO.C6H13N/c1-3-8(11)9(2)4-6-10-7-5-9;1-6-2-4-7-5-3-6/h10H,3-7H2,1-2H3;6-7H,2-5H2,1H3.
What are the key properties of 4-methylpiperidine;1-(4-methylpiperidin-4-yl)propan-1-one?
4-methylpiperidine;1-(4-methylpiperidin-4-yl)propan-1-one has a molecular weight of 254.42 g/mol, XLogP of 2.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpiperidine;1-(4-methylpiperidin-4-yl)propan-1-one is sourced from PubChem (CID 90894414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).