C19H22FNO4 — CID 9089452
N-[(1R)-1-(4-fluorophenyl)ethyl]-2-(2,3,4-trimethoxyphenyl)acetamide (PubChem CID 9089452) has the molecular formula C19H22FNO4 and a molecular weight of 347.39 g/mol. Its IUPAC name is N-[(1R)-1-(4-fluorophenyl)ethyl]-2-(2,3,4-trimethoxyphenyl)acetamide.
| Compound Name | N-[(1R)-1-(4-fluorophenyl)ethyl]-2-(2,3,4-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9089452 |
| Molecular Formula | C19H22FNO4 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[(1R)-1-(4-fluorophenyl)ethyl]-2-(2,3,4-trimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N[C@H](C)c2ccc(F)cc2)c(OC)c1OC |
| InChI | InChI=1S/C19H22FNO4/c1-12(13-5-8-15(20)9-6-13)21-17(22)11-14-7-10-16(23-2)19(25-4)18(14)24-3/h5-10,12H,11H2,1-4H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | AGWIZNHVXUSSFQ-GFCCVEGCSA-N |
| XLogP | 3.27 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |