About [(2S)-2,3-dihydro-1,4-benzoxathiin-2-yl]methanol;ethane
[(2S)-2,3-dihydro-1,4-benzoxathiin-2-yl]methanol;ethane (PubChem CID 90894780) has the molecular formula C11H16O2S
and a molecular weight of 212.31 g/mol. Its IUPAC name is [(2S)-2,3-dihydro-1,4-benzoxathiin-2-yl]methanol;ethane.
Molecular Properties
| Compound Name | [(2S)-2,3-dihydro-1,4-benzoxathiin-2-yl]methanol;ethane |
| PubChem CID | 90894780 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | [(2S)-2,3-dihydro-1,4-benzoxathiin-2-yl]methanol;ethane |
| SMILES | CC.OC[C@H]1CSc2ccccc2O1 |
| InChI | InChI=1S/C9H10O2S.C2H6/c10-5-7-6-12-9-4-2-1-3-8(9)11-7;1-2/h1-4,7,10H,5-6H2;1-2H3/t7-;/m0./s1 |
| InChIKey | HQZGJIDTESQMLU-FJXQXJEOSA-N |
| XLogP | 2.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-2,3-dihydro-1,4-benzoxathiin-2-yl]methanol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2,3-dihydro-1,4-benzoxathiin-2-yl]methanol;ethane?
The IUPAC name of [(2S)-2,3-dihydro-1,4-benzoxathiin-2-yl]methanol;ethane (CID 90894780) is [(2S)-2,3-dihydro-1,4-benzoxathiin-2-yl]methanol;ethane.
What is the SMILES notation for [(2S)-2,3-dihydro-1,4-benzoxathiin-2-yl]methanol;ethane?
The canonical SMILES for [(2S)-2,3-dihydro-1,4-benzoxathiin-2-yl]methanol;ethane is CC.OC[C@H]1CSc2ccccc2O1.
What is the InChIKey of [(2S)-2,3-dihydro-1,4-benzoxathiin-2-yl]methanol;ethane?
The InChIKey is HQZGJIDTESQMLU-FJXQXJEOSA-N. The full InChI is InChI=1S/C9H10O2S.C2H6/c10-5-7-6-12-9-4-2-1-3-8(9)11-7;1-2/h1-4,7,10H,5-6H2;1-2H3/t7-;/m0./s1.
What are the key properties of [(2S)-2,3-dihydro-1,4-benzoxathiin-2-yl]methanol;ethane?
[(2S)-2,3-dihydro-1,4-benzoxathiin-2-yl]methanol;ethane has a molecular weight of 212.31 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2,3-dihydro-1,4-benzoxathiin-2-yl]methanol;ethane is sourced from PubChem (CID 90894780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).