C26H36O6SSi — CID 90895023
[(3R,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethylsulfanyl-4,5-dihydroxyoxan-3-yl] acetate (PubChem CID 90895023) has the molecular formula C26H36O6SSi and a molecular weight of 504.72 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethylsulfanyl-4,5-dihydroxyoxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethylsulfanyl-4,5-dihydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 90895023 |
| Molecular Formula | C26H36O6SSi |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | [(3R,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethylsulfanyl-4,5-dihydroxyoxan-3-yl] acetate |
| SMILES | CCSC1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O)[C@H](O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H36O6SSi/c1-6-33-25-24(31-18(2)27)23(29)22(28)21(32-25)17-30-34(26(3,4)5,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,21-25,28-29H,6,17H2,1-5H3/t21-,22+,23+,24-,25?/m1/s1 |
| InChIKey | OZKDLNIJHOIZOQ-VJIQZMARSA-N |
| XLogP | 2.69 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|