C25H22F3N3O8 — CID 90895041
2-[1-(1,3-benzodioxol-5-yl)-2-[2-[2-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-yl)ethyl]-3-oxo-1,2-oxazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid (PubChem CID 90895041) has the molecular formula C25H22F3N3O8 and a molecular weight of 549.46 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-yl)-2-[2-[2-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-yl)ethyl]-3-oxo-1,2-oxazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid.
| Compound Name | 2-[1-(1,3-benzodioxol-5-yl)-2-[2-[2-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-yl)ethyl]-3-oxo-1,2-oxazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid |
|---|---|
| PubChem CID | 90895041 |
| Molecular Formula | C25H22F3N3O8 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-yl)-2-[2-[2-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-yl)ethyl]-3-oxo-1,2-oxazol-5-yl]ethyl]-4,4,4-trifluoro-3-oxobutanoic acid |
| SMILES | O=C(O)C(C(=O)C(F)(F)F)C(Cc1cc(=O)n(CCc2ccc3c(n2)NCCO3)o1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H22F3N3O8/c26-25(27,28)22(33)21(24(34)35)16(13-1-3-17-19(9-13)38-12-37-17)10-15-11-20(32)31(39-15)7-5-14-2-4-18-23(30-14)29-6-8-36-18/h1-4,9,11,16,21H,5-8,10,12H2,(H,29,30)(H,34,35) |
| InChIKey | QCMZYNNTCRSPFY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 142.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|