C23H27N3O4 — CID 9089506
N'-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propanoyl]-3-methylbenzo[g][1]benzofuran-2-carbohydrazide (PubChem CID 9089506) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is N'-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propanoyl]-3-methylbenzo[g][1]benzofuran-2-carbohydrazide.
| Compound Name | N'-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propanoyl]-3-methylbenzo[g][1]benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 9089506 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N'-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propanoyl]-3-methylbenzo[g][1]benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)CCN2C[C@@H](C)O[C@@H](C)C2)oc2c1ccc1ccccc12 |
| InChI | InChI=1S/C23H27N3O4/c1-14-12-26(13-15(2)29-14)11-10-20(27)24-25-23(28)21-16(3)18-9-8-17-6-4-5-7-19(17)22(18)30-21/h4-9,14-15H,10-13H2,1-3H3,(H,24,27)(H,25,28)/t14-,15+ |
| InChIKey | ROJPWUDLTASCGQ-GASCZTMLSA-N |
| XLogP | 3.15 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|