C11H25N2P — CID 90895376
4,6-dimethyl-1,3-di(propan-2-yl)-1,3,2-diazaphosphinane (PubChem CID 90895376) has the molecular formula C11H25N2P and a molecular weight of 216.31 g/mol. Its IUPAC name is 4,6-dimethyl-1,3-di(propan-2-yl)-1,3,2-diazaphosphinane.
| Compound Name | 4,6-dimethyl-1,3-di(propan-2-yl)-1,3,2-diazaphosphinane |
|---|---|
| PubChem CID | 90895376 |
| Molecular Formula | C11H25N2P |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 4,6-dimethyl-1,3-di(propan-2-yl)-1,3,2-diazaphosphinane |
| SMILES | CC(C)N1PN(C(C)C)C(C)CC1C |
| InChI | InChI=1S/C11H25N2P/c1-8(2)12-10(5)7-11(6)13(14-12)9(3)4/h8-11,14H,7H2,1-6H3 |
| InChIKey | YYWHLQDKRYSKJB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|