About 4-[2-(aminomethylsulfanyl)ethyl]-2,3-dihydrochromen-4-amine
4-[2-(aminomethylsulfanyl)ethyl]-2,3-dihydrochromen-4-amine (PubChem CID 90895419) has the molecular formula C12H18N2OS
and a molecular weight of 238.36 g/mol. Its IUPAC name is 4-[2-(aminomethylsulfanyl)ethyl]-2,3-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | 4-[2-(aminomethylsulfanyl)ethyl]-2,3-dihydrochromen-4-amine |
| PubChem CID | 90895419 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-[2-(aminomethylsulfanyl)ethyl]-2,3-dihydrochromen-4-amine |
| SMILES | NCSCCC1(N)CCOc2ccccc21 |
| InChI | InChI=1S/C12H18N2OS/c13-9-16-8-6-12(14)5-7-15-11-4-2-1-3-10(11)12/h1-4H,5-9,13-14H2 |
| InChIKey | WMCNTZGSFZEHAS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(aminomethylsulfanyl)ethyl]-2,3-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(aminomethylsulfanyl)ethyl]-2,3-dihydrochromen-4-amine?
The IUPAC name of 4-[2-(aminomethylsulfanyl)ethyl]-2,3-dihydrochromen-4-amine (CID 90895419) is 4-[2-(aminomethylsulfanyl)ethyl]-2,3-dihydrochromen-4-amine.
What is the SMILES notation for 4-[2-(aminomethylsulfanyl)ethyl]-2,3-dihydrochromen-4-amine?
The canonical SMILES for 4-[2-(aminomethylsulfanyl)ethyl]-2,3-dihydrochromen-4-amine is NCSCCC1(N)CCOc2ccccc21.
What is the InChIKey of 4-[2-(aminomethylsulfanyl)ethyl]-2,3-dihydrochromen-4-amine?
The InChIKey is WMCNTZGSFZEHAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2OS/c13-9-16-8-6-12(14)5-7-15-11-4-2-1-3-10(11)12/h1-4H,5-9,13-14H2.
What are the key properties of 4-[2-(aminomethylsulfanyl)ethyl]-2,3-dihydrochromen-4-amine?
4-[2-(aminomethylsulfanyl)ethyl]-2,3-dihydrochromen-4-amine has a molecular weight of 238.36 g/mol, XLogP of 1.66, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(aminomethylsulfanyl)ethyl]-2,3-dihydrochromen-4-amine is sourced from PubChem (CID 90895419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).