C21H18BrClN6O4S2 — CID 90895542
4-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-5-(4-chlorophenyl)-6-[[methyl(thiophen-2-yl)sulfamoyl]amino]pyrimidine (PubChem CID 90895542) has the molecular formula C21H18BrClN6O4S2 and a molecular weight of 597.90 g/mol. Its IUPAC name is 4-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-5-(4-chlorophenyl)-6-[[methyl(thiophen-2-yl)sulfamoyl]amino]pyrimidine.
| Compound Name | 4-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-5-(4-chlorophenyl)-6-[[methyl(thiophen-2-yl)sulfamoyl]amino]pyrimidine |
|---|---|
| PubChem CID | 90895542 |
| Molecular Formula | C21H18BrClN6O4S2 |
| Molecular Weight | 597.90 g/mol |
| Exact Mass | 595.97 |
| IUPAC Name | 4-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-5-(4-chlorophenyl)-6-[[methyl(thiophen-2-yl)sulfamoyl]amino]pyrimidine |
| SMILES | CN(c1cccs1)S(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18BrClN6O4S2/c1-29(17-3-2-10-34-17)35(30,31)28-19-18(14-4-6-16(23)7-5-14)20(27-13-26-19)32-8-9-33-21-24-11-15(22)12-25-21/h2-7,10-13H,8-9H2,1H3,(H,26,27,28) |
| InChIKey | DCNYMZHJYGMUAP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.90 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|