C23H38O3 — CID 90895797
3-ethyl-1-methoxy-6-methyl-4-(2,5,7,7-tetramethyloct-4-en-2-yl)hepta-3,6-diene-2,5-dione (PubChem CID 90895797) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is 3-ethyl-1-methoxy-6-methyl-4-(2,5,7,7-tetramethyloct-4-en-2-yl)hepta-3,6-diene-2,5-dione.
| Compound Name | 3-ethyl-1-methoxy-6-methyl-4-(2,5,7,7-tetramethyloct-4-en-2-yl)hepta-3,6-diene-2,5-dione |
|---|---|
| PubChem CID | 90895797 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 3-ethyl-1-methoxy-6-methyl-4-(2,5,7,7-tetramethyloct-4-en-2-yl)hepta-3,6-diene-2,5-dione |
| SMILES | C=C(C)C(=O)C(=C(CC)C(=O)COC)C(C)(C)CC=C(C)CC(C)(C)C |
| InChI | InChI=1S/C23H38O3/c1-11-18(19(24)15-26-10)20(21(25)16(2)3)23(8,9)13-12-17(4)14-22(5,6)7/h12H,2,11,13-15H2,1,3-10H3 |
| InChIKey | SLHUBZSZEBRTDO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|