C16H20O5 — CID 90895919
(8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoic acid (PubChem CID 90895919) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoic acid.
| Compound Name | (8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 90895919 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoic acid |
| SMILES | COC1=CC[C@@H]([C@@H](C)C=C(C)C=CC=CC(=O)O)OC1=O |
| InChI | InChI=1S/C16H20O5/c1-11(6-4-5-7-15(17)18)10-12(2)13-8-9-14(20-3)16(19)21-13/h4-7,9-10,12-13H,8H2,1-3H3,(H,17,18)/t12-,13-/m0/s1 |
| InChIKey | FRTIXLQMJPERSX-STQMWFEESA-N |
| XLogP | 2.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|