C21H17F2N5O — CID 90896024
4-fluoro-3-[[3-fluoro-4-[(5-methylpyrazin-2-yl)methylamino]phenyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 90896024) has the molecular formula C21H17F2N5O and a molecular weight of 393.40 g/mol. Its IUPAC name is 4-fluoro-3-[[3-fluoro-4-[(5-methylpyrazin-2-yl)methylamino]phenyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 4-fluoro-3-[[3-fluoro-4-[(5-methylpyrazin-2-yl)methylamino]phenyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90896024 |
| Molecular Formula | C21H17F2N5O |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 4-fluoro-3-[[3-fluoro-4-[(5-methylpyrazin-2-yl)methylamino]phenyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | Cc1cnc(CNc2ccc(/N=C/C3C(=O)Nc4cccc(F)c43)cc2F)cn1 |
| InChI | InChI=1S/C21H17F2N5O/c1-12-8-25-14(9-24-12)10-27-18-6-5-13(7-17(18)23)26-11-15-20-16(22)3-2-4-19(20)28-21(15)29/h2-9,11,15,27H,10H2,1H3,(H,28,29)/b26-11+ |
| InChIKey | BGPKTXIWBFLKTA-KBKYJPHKSA-N |
| XLogP | 4.11 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|